About 1-(3-iodopropyl)indole
1-(3-iodopropyl)indole (PubChem CID 11323600) has the molecular formula C11H12IN
and a molecular weight of 285.13 g/mol. Its IUPAC name is 1-(3-iodopropyl)indole.
Molecular Properties
| Compound Name | 1-(3-iodopropyl)indole |
| PubChem CID | 11323600 |
| Molecular Formula | C11H12IN |
| Molecular Weight | 285.13 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | 1-(3-iodopropyl)indole |
| SMILES | ICCCn1ccc2ccccc21 |
| InChI | InChI=1S/C11H12IN/c12-7-3-8-13-9-6-10-4-1-2-5-11(10)13/h1-2,4-6,9H,3,7-8H2 |
| InChIKey | XIGPZCRZBBORMO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.13 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-iodopropyl)indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-iodopropyl)indole?
The IUPAC name of 1-(3-iodopropyl)indole (CID 11323600) is 1-(3-iodopropyl)indole.
What is the SMILES notation for 1-(3-iodopropyl)indole?
The canonical SMILES for 1-(3-iodopropyl)indole is ICCCn1ccc2ccccc21.
What is the InChIKey of 1-(3-iodopropyl)indole?
The InChIKey is XIGPZCRZBBORMO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12IN/c12-7-3-8-13-9-6-10-4-1-2-5-11(10)13/h1-2,4-6,9H,3,7-8H2.
What are the key properties of 1-(3-iodopropyl)indole?
1-(3-iodopropyl)indole has a molecular weight of 285.13 g/mol, XLogP of 3.47, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-iodopropyl)indole is sourced from PubChem (CID 11323600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).