About 1-(2-phenylethyl)indole
1-(2-phenylethyl)indole (PubChem CID 12601752) has the molecular formula C16H15N
and a molecular weight of 221.30 g/mol. Its IUPAC name is 1-(2-phenylethyl)indole.
Molecular Properties
| Compound Name | 1-(2-phenylethyl)indole |
| PubChem CID | 12601752 |
| Molecular Formula | C16H15N |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 1-(2-phenylethyl)indole |
| SMILES | c1ccc(CCn2ccc3ccccc32)cc1 |
| InChI | InChI=1S/C16H15N/c1-2-6-14(7-3-1)10-12-17-13-11-15-8-4-5-9-16(15)17/h1-9,11,13H,10,12H2 |
| InChIKey | AUHQAAVJJYGEIU-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(2-phenylethyl)indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-phenylethyl)indole?
The IUPAC name of 1-(2-phenylethyl)indole (CID 12601752) is 1-(2-phenylethyl)indole.
What is the SMILES notation for 1-(2-phenylethyl)indole?
The canonical SMILES for 1-(2-phenylethyl)indole is c1ccc(CCn2ccc3ccccc32)cc1.
What is the InChIKey of 1-(2-phenylethyl)indole?
The InChIKey is AUHQAAVJJYGEIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N/c1-2-6-14(7-3-1)10-12-17-13-11-15-8-4-5-9-16(15)17/h1-9,11,13H,10,12H2.
What are the key properties of 1-(2-phenylethyl)indole?
1-(2-phenylethyl)indole has a molecular weight of 221.30 g/mol, XLogP of 3.88, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-phenylethyl)indole is sourced from PubChem (CID 12601752), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).