About 1-(2-fluoroethyl)indole
1-(2-fluoroethyl)indole (PubChem CID 80694500) has the molecular formula C10H10FN
and a molecular weight of 163.19 g/mol. Its IUPAC name is 1-(2-fluoroethyl)indole.
Molecular Properties
| Compound Name | 1-(2-fluoroethyl)indole |
| PubChem CID | 80694500 |
| Molecular Formula | C10H10FN |
| Molecular Weight | 163.19 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | 1-(2-fluoroethyl)indole |
| SMILES | FCCn1ccc2ccccc21 |
| InChI | InChI=1S/C10H10FN/c11-6-8-12-7-5-9-3-1-2-4-10(9)12/h1-5,7H,6,8H2 |
| InChIKey | BHKHNAXLUSBZGK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.19 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(2-fluoroethyl)indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-fluoroethyl)indole?
The IUPAC name of 1-(2-fluoroethyl)indole (CID 80694500) is 1-(2-fluoroethyl)indole.
What is the SMILES notation for 1-(2-fluoroethyl)indole?
The canonical SMILES for 1-(2-fluoroethyl)indole is FCCn1ccc2ccccc21.
What is the InChIKey of 1-(2-fluoroethyl)indole?
The InChIKey is BHKHNAXLUSBZGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10FN/c11-6-8-12-7-5-9-3-1-2-4-10(9)12/h1-5,7H,6,8H2.
What are the key properties of 1-(2-fluoroethyl)indole?
1-(2-fluoroethyl)indole has a molecular weight of 163.19 g/mol, XLogP of 2.61, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-fluoroethyl)indole is sourced from PubChem (CID 80694500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).