C17H25N — CID 57308424
1-(3,6-dimethylheptyl)indole (PubChem CID 57308424) has the molecular formula C17H25N and a molecular weight of 243.39 g/mol. Its IUPAC name is 1-(3,6-dimethylheptyl)indole.
| Compound Name | 1-(3,6-dimethylheptyl)indole |
|---|---|
| PubChem CID | 57308424 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | 1-(3,6-dimethylheptyl)indole |
| SMILES | CC(C)CCC(C)CCn1ccc2ccccc21 |
| InChI | InChI=1S/C17H25N/c1-14(2)8-9-15(3)10-12-18-13-11-16-6-4-5-7-17(16)18/h4-7,11,13-15H,8-10,12H2,1-3H3 |
| InChIKey | MQLSNXVZMRYIPS-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |