About 1-ethylindole;propane
1-ethylindole;propane (PubChem CID 91144409) has the molecular formula C13H19N
and a molecular weight of 189.30 g/mol. Its IUPAC name is 1-ethylindole;propane.
Molecular Properties
| Compound Name | 1-ethylindole;propane |
| PubChem CID | 91144409 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 1-ethylindole;propane |
| SMILES | CCC.CCn1ccc2ccccc21 |
| InChI | InChI=1S/C10H11N.C3H8/c1-2-11-8-7-9-5-3-4-6-10(9)11;1-3-2/h3-8H,2H2,1H3;3H2,1-2H3 |
| InChIKey | ROTHRDOMCRLVOW-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-ethylindole;propane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethylindole;propane?
The IUPAC name of 1-ethylindole;propane (CID 91144409) is 1-ethylindole;propane.
What is the SMILES notation for 1-ethylindole;propane?
The canonical SMILES for 1-ethylindole;propane is CCC.CCn1ccc2ccccc21.
What is the InChIKey of 1-ethylindole;propane?
The InChIKey is ROTHRDOMCRLVOW-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N.C3H8/c1-2-11-8-7-9-5-3-4-6-10(9)11;1-3-2/h3-8H,2H2,1H3;3H2,1-2H3.
What are the key properties of 1-ethylindole;propane?
1-ethylindole;propane has a molecular weight of 189.30 g/mol, XLogP of 4.08, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethylindole;propane is sourced from PubChem (CID 91144409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).