C13H18N2 — CID 154694251
1-indol-1-yl-N,N-dimethylpropan-2-amine (PubChem CID 154694251) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is 1-indol-1-yl-N,N-dimethylpropan-2-amine.
| Compound Name | 1-indol-1-yl-N,N-dimethylpropan-2-amine |
|---|---|
| PubChem CID | 154694251 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | 1-indol-1-yl-N,N-dimethylpropan-2-amine |
| SMILES | CC(Cn1ccc2ccccc21)N(C)C |
| InChI | InChI=1S/C13H18N2/c1-11(14(2)3)10-15-9-8-12-6-4-5-7-13(12)15/h4-9,11H,10H2,1-3H3 |
| InChIKey | SKVBDYFAWYZCMF-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |