C20H20N2O2 — CID 131853579
(2S,3S)-1,4-di(indol-1-yl)butane-2,3-diol (PubChem CID 131853579) has the molecular formula C20H20N2O2 and a molecular weight of 320.39 g/mol. Its IUPAC name is (2S,3S)-1,4-di(indol-1-yl)butane-2,3-diol.
| Compound Name | (2S,3S)-1,4-di(indol-1-yl)butane-2,3-diol |
|---|---|
| PubChem CID | 131853579 |
| Molecular Formula | C20H20N2O2 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.15 |
| IUPAC Name | (2S,3S)-1,4-di(indol-1-yl)butane-2,3-diol |
| SMILES | O[C@@H](Cn1ccc2ccccc21)[C@@H](O)Cn1ccc2ccccc21 |
| InChI | InChI=1S/C20H20N2O2/c23-19(13-21-11-9-15-5-1-3-7-17(15)21)20(24)14-22-12-10-16-6-2-4-8-18(16)22/h1-12,19-20,23-24H,13-14H2/t19-,20-/m0/s1 |
| InChIKey | ZDZZSFKQIQHSID-PMACEKPBSA-N |
| XLogP | 3.02 |
| TPSA | 50.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |