C13H18N2O4S — CID 178146608
[1-[(2R)-2-(dimethylamino)propyl]indol-5-yl] hydrogen sulfate (PubChem CID 178146608) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is [1-[(2R)-2-(dimethylamino)propyl]indol-5-yl] hydrogen sulfate.
| Compound Name | [1-[(2R)-2-(dimethylamino)propyl]indol-5-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 178146608 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | [1-[(2R)-2-(dimethylamino)propyl]indol-5-yl] hydrogen sulfate |
| SMILES | C[C@H](Cn1ccc2cc(OS(=O)(=O)O)ccc21)N(C)C |
| InChI | InChI=1S/C13H18N2O4S/c1-10(14(2)3)9-15-7-6-11-8-12(4-5-13(11)15)19-20(16,17)18/h4-8,10H,9H2,1-3H3,(H,16,17,18)/t10-/m1/s1 |
| InChIKey | AEKIIDLABPOPQB-SNVBAGLBSA-N |
| XLogP | 1.77 |
| TPSA | 71.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|