About acetic acid;1-butylindole
acetic acid;1-butylindole (PubChem CID 162326365) has the molecular formula C14H19NO2
and a molecular weight of 233.31 g/mol. Its IUPAC name is acetic acid;1-butylindole.
Molecular Properties
| Compound Name | acetic acid;1-butylindole |
| PubChem CID | 162326365 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | acetic acid;1-butylindole |
| SMILES | CC(=O)O.CCCCn1ccc2ccccc21 |
| InChI | InChI=1S/C12H15N.C2H4O2/c1-2-3-9-13-10-8-11-6-4-5-7-12(11)13;1-2(3)4/h4-8,10H,2-3,9H2,1H3;1H3,(H,3,4) |
| InChIKey | JSRREYNZHKRISO-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze acetic acid;1-butylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;1-butylindole?
The IUPAC name of acetic acid;1-butylindole (CID 162326365) is acetic acid;1-butylindole.
What is the SMILES notation for acetic acid;1-butylindole?
The canonical SMILES for acetic acid;1-butylindole is CC(=O)O.CCCCn1ccc2ccccc21.
What is the InChIKey of acetic acid;1-butylindole?
The InChIKey is JSRREYNZHKRISO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N.C2H4O2/c1-2-3-9-13-10-8-11-6-4-5-7-12(11)13;1-2(3)4/h4-8,10H,2-3,9H2,1H3;1H3,(H,3,4).
What are the key properties of acetic acid;1-butylindole?
acetic acid;1-butylindole has a molecular weight of 233.31 g/mol, XLogP of 3.53, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;1-butylindole is sourced from PubChem (CID 162326365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).