About 1-indol-1-ylheptan-4-one
1-indol-1-ylheptan-4-one (PubChem CID 142802450) has the molecular formula C15H19NO
and a molecular weight of 229.32 g/mol. Its IUPAC name is 1-indol-1-ylheptan-4-one.
Molecular Properties
| Compound Name | 1-indol-1-ylheptan-4-one |
| PubChem CID | 142802450 |
| Molecular Formula | C15H19NO |
| Molecular Weight | 229.32 g/mol |
| Exact Mass | 229.15 |
| IUPAC Name | 1-indol-1-ylheptan-4-one |
| SMILES | CCCC(=O)CCCn1ccc2ccccc21 |
| InChI | InChI=1S/C15H19NO/c1-2-6-14(17)8-5-11-16-12-10-13-7-3-4-9-15(13)16/h3-4,7,9-10,12H,2,5-6,8,11H2,1H3 |
| InChIKey | SRXZXPBLVAKWKY-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.32 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-indol-1-ylheptan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-indol-1-ylheptan-4-one?
The IUPAC name of 1-indol-1-ylheptan-4-one (CID 142802450) is 1-indol-1-ylheptan-4-one.
What is the SMILES notation for 1-indol-1-ylheptan-4-one?
The canonical SMILES for 1-indol-1-ylheptan-4-one is CCCC(=O)CCCn1ccc2ccccc21.
What is the InChIKey of 1-indol-1-ylheptan-4-one?
The InChIKey is SRXZXPBLVAKWKY-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO/c1-2-6-14(17)8-5-11-16-12-10-13-7-3-4-9-15(13)16/h3-4,7,9-10,12H,2,5-6,8,11H2,1H3.
What are the key properties of 1-indol-1-ylheptan-4-one?
1-indol-1-ylheptan-4-one has a molecular weight of 229.32 g/mol, XLogP of 3.79, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-indol-1-ylheptan-4-one is sourced from PubChem (CID 142802450), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).