About 1-(3-fluoropropyl)indole
1-(3-fluoropropyl)indole (PubChem CID 81113690) has the molecular formula C11H12FN
and a molecular weight of 177.22 g/mol. Its IUPAC name is 1-(3-fluoropropyl)indole.
Molecular Properties
| Compound Name | 1-(3-fluoropropyl)indole |
| PubChem CID | 81113690 |
| Molecular Formula | C11H12FN |
| Molecular Weight | 177.22 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 1-(3-fluoropropyl)indole |
| SMILES | FCCCn1ccc2ccccc21 |
| InChI | InChI=1S/C11H12FN/c12-7-3-8-13-9-6-10-4-1-2-5-11(10)13/h1-2,4-6,9H,3,7-8H2 |
| InChIKey | MZRXSPNABOAWCE-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.22 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(3-fluoropropyl)indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-fluoropropyl)indole?
The IUPAC name of 1-(3-fluoropropyl)indole (CID 81113690) is 1-(3-fluoropropyl)indole.
What is the SMILES notation for 1-(3-fluoropropyl)indole?
The canonical SMILES for 1-(3-fluoropropyl)indole is FCCCn1ccc2ccccc21.
What is the InChIKey of 1-(3-fluoropropyl)indole?
The InChIKey is MZRXSPNABOAWCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12FN/c12-7-3-8-13-9-6-10-4-1-2-5-11(10)13/h1-2,4-6,9H,3,7-8H2.
What are the key properties of 1-(3-fluoropropyl)indole?
1-(3-fluoropropyl)indole has a molecular weight of 177.22 g/mol, XLogP of 3.00, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-fluoropropyl)indole is sourced from PubChem (CID 81113690), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).