C11H10N4O2 — CID 71540686
1-(3-azidopropyl)indole-2,3-dione (PubChem CID 71540686) has the molecular formula C11H10N4O2 and a molecular weight of 230.23 g/mol. Its IUPAC name is 1-(3-azidopropyl)indole-2,3-dione.
| Compound Name | 1-(3-azidopropyl)indole-2,3-dione |
|---|---|
| PubChem CID | 71540686 |
| Molecular Formula | C11H10N4O2 |
| Molecular Weight | 230.23 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 1-(3-azidopropyl)indole-2,3-dione |
| SMILES | [N-]=[N+]=NCCCN1C(=O)C(=O)c2ccccc21 |
| InChI | InChI=1S/C11H10N4O2/c12-14-13-6-3-7-15-9-5-2-1-4-8(9)10(16)11(15)17/h1-2,4-5H,3,6-7H2 |
| InChIKey | FBEQKVUTLHJSDD-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 86.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.23 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|