C13H13FN4O2 — CID 154714868
2-(5-azido-4-fluoropentyl)isoindole-1,3-dione (PubChem CID 154714868) has the molecular formula C13H13FN4O2 and a molecular weight of 276.27 g/mol. Its IUPAC name is 2-(5-azido-4-fluoropentyl)isoindole-1,3-dione.
| Compound Name | 2-(5-azido-4-fluoropentyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 154714868 |
| Molecular Formula | C13H13FN4O2 |
| Molecular Weight | 276.27 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 2-(5-azido-4-fluoropentyl)isoindole-1,3-dione |
| SMILES | [N-]=[N+]=NCC(F)CCCN1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C13H13FN4O2/c14-9(8-16-17-15)4-3-7-18-12(19)10-5-1-2-6-11(10)13(18)20/h1-2,5-6,9H,3-4,7-8H2 |
| InChIKey | NGXRDIITURCJAE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 86.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.27 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|