C22H25N3O2 — CID 23363916
1-[3-(4-benzylpiperazin-1-yl)propyl]indole-2,3-dione (PubChem CID 23363916) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is 1-[3-(4-benzylpiperazin-1-yl)propyl]indole-2,3-dione.
| Compound Name | 1-[3-(4-benzylpiperazin-1-yl)propyl]indole-2,3-dione |
|---|---|
| PubChem CID | 23363916 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 1-[3-(4-benzylpiperazin-1-yl)propyl]indole-2,3-dione |
| SMILES | O=C1C(=O)N(CCCN2CCN(Cc3ccccc3)CC2)c2ccccc21 |
| InChI | InChI=1S/C22H25N3O2/c26-21-19-9-4-5-10-20(19)25(22(21)27)12-6-11-23-13-15-24(16-14-23)17-18-7-2-1-3-8-18/h1-5,7-10H,6,11-17H2 |
| InChIKey | RJFRUZZLSWWYHQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|