C22H27Cl2N3O3 — CID 23363958
1-[2-[4-[(2-methoxyphenyl)methyl]piperazin-1-yl]ethyl]indole-2,3-dione;dihydrochloride (PubChem CID 23363958) has the molecular formula C22H27Cl2N3O3 and a molecular weight of 452.38 g/mol. Its IUPAC name is 1-[2-[4-[(2-methoxyphenyl)methyl]piperazin-1-yl]ethyl]indole-2,3-dione;dihydrochloride.
| Compound Name | 1-[2-[4-[(2-methoxyphenyl)methyl]piperazin-1-yl]ethyl]indole-2,3-dione;dihydrochloride |
|---|---|
| PubChem CID | 23363958 |
| Molecular Formula | C22H27Cl2N3O3 |
| Molecular Weight | 452.38 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | 1-[2-[4-[(2-methoxyphenyl)methyl]piperazin-1-yl]ethyl]indole-2,3-dione;dihydrochloride |
| SMILES | COc1ccccc1CN1CCN(CCN2C(=O)C(=O)c3ccccc32)CC1.Cl.Cl |
| InChI | InChI=1S/C22H25N3O3.2ClH/c1-28-20-9-5-2-6-17(20)16-24-12-10-23(11-13-24)14-15-25-19-8-4-3-7-18(19)21(26)22(25)27;;/h2-9H,10-16H2,1H3;2*1H |
| InChIKey | SYUDDXHLZJIZRJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.38 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|