C24H23N3O2 — CID 9282637
1-[[4-(naphthalen-1-ylmethyl)piperazin-1-yl]methyl]indole-2,3-dione (PubChem CID 9282637) has the molecular formula C24H23N3O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is 1-[[4-(naphthalen-1-ylmethyl)piperazin-1-yl]methyl]indole-2,3-dione.
| Compound Name | 1-[[4-(naphthalen-1-ylmethyl)piperazin-1-yl]methyl]indole-2,3-dione |
|---|---|
| PubChem CID | 9282637 |
| Molecular Formula | C24H23N3O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 1-[[4-(naphthalen-1-ylmethyl)piperazin-1-yl]methyl]indole-2,3-dione |
| SMILES | O=C1C(=O)N(CN2CCN(Cc3cccc4ccccc34)CC2)c2ccccc21 |
| InChI | InChI=1S/C24H23N3O2/c28-23-21-10-3-4-11-22(21)27(24(23)29)17-26-14-12-25(13-15-26)16-19-8-5-7-18-6-1-2-9-20(18)19/h1-11H,12-17H2 |
| InChIKey | COCUADYTNVHBRA-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|