C29H31N3O2 — CID 20502497
1-[4-(4-benzhydrylpiperazin-1-yl)butyl]indole-2,3-dione (PubChem CID 20502497) has the molecular formula C29H31N3O2 and a molecular weight of 453.59 g/mol. Its IUPAC name is 1-[4-(4-benzhydrylpiperazin-1-yl)butyl]indole-2,3-dione.
| Compound Name | 1-[4-(4-benzhydrylpiperazin-1-yl)butyl]indole-2,3-dione |
|---|---|
| PubChem CID | 20502497 |
| Molecular Formula | C29H31N3O2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.24 |
| IUPAC Name | 1-[4-(4-benzhydrylpiperazin-1-yl)butyl]indole-2,3-dione |
| SMILES | O=C1C(=O)N(CCCCN2CCN(C(c3ccccc3)c3ccccc3)CC2)c2ccccc21 |
| InChI | InChI=1S/C29H31N3O2/c33-28-25-15-7-8-16-26(25)32(29(28)34)18-10-9-17-30-19-21-31(22-20-30)27(23-11-3-1-4-12-23)24-13-5-2-6-14-24/h1-8,11-16,27H,9-10,17-22H2 |
| InChIKey | VCQGLUJYFQLLBH-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|