C27H40N2O3S — CID 19700573
10-(4-benzhydrylpiperazin-1-yl)decane-1-sulfonic acid (PubChem CID 19700573) has the molecular formula C27H40N2O3S and a molecular weight of 472.70 g/mol. Its IUPAC name is 10-(4-benzhydrylpiperazin-1-yl)decane-1-sulfonic acid.
| Compound Name | 10-(4-benzhydrylpiperazin-1-yl)decane-1-sulfonic acid |
|---|---|
| PubChem CID | 19700573 |
| Molecular Formula | C27H40N2O3S |
| Molecular Weight | 472.70 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | 10-(4-benzhydrylpiperazin-1-yl)decane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCCCCCCCCN1CCN(C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C27H40N2O3S/c30-33(31,32)24-14-6-4-2-1-3-5-13-19-28-20-22-29(23-21-28)27(25-15-9-7-10-16-25)26-17-11-8-12-18-26/h7-12,15-18,27H,1-6,13-14,19-24H2,(H,30,31,32) |
| InChIKey | GTJYATGKJVDKBD-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.70 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|