C16H34N2O4S — CID 132598884
10-[4-(2-hydroxyethyl)piperazin-1-yl]decane-1-sulfonic acid (PubChem CID 132598884) has the molecular formula C16H34N2O4S and a molecular weight of 350.53 g/mol. Its IUPAC name is 10-[4-(2-hydroxyethyl)piperazin-1-yl]decane-1-sulfonic acid.
| Compound Name | 10-[4-(2-hydroxyethyl)piperazin-1-yl]decane-1-sulfonic acid |
|---|---|
| PubChem CID | 132598884 |
| Molecular Formula | C16H34N2O4S |
| Molecular Weight | 350.53 g/mol |
| Exact Mass | 350.22 |
| IUPAC Name | 10-[4-(2-hydroxyethyl)piperazin-1-yl]decane-1-sulfonic acid |
| SMILES | O=S(=O)(O)CCCCCCCCCCN1CCN(CCO)CC1 |
| InChI | InChI=1S/C16H34N2O4S/c19-15-14-18-12-10-17(11-13-18)9-7-5-3-1-2-4-6-8-16-23(20,21)22/h19H,1-16H2,(H,20,21,22) |
| InChIKey | GAOREGIZIUVMGI-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.53 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|