C10H24N2O5S2 — CID 87984514
2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid;2-sulfanylethanol (PubChem CID 87984514) has the molecular formula C10H24N2O5S2 and a molecular weight of 316.45 g/mol. Its IUPAC name is 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid;2-sulfanylethanol.
| Compound Name | 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid;2-sulfanylethanol |
|---|---|
| PubChem CID | 87984514 |
| Molecular Formula | C10H24N2O5S2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.11 |
| IUPAC Name | 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid;2-sulfanylethanol |
| SMILES | O=S(=O)(O)CCN1CCN(CCO)CC1.OCCS |
| InChI | InChI=1S/C8H18N2O4S.C2H6OS/c11-7-5-9-1-3-10(4-2-9)6-8-15(12,13)14;3-1-2-4/h11H,1-8H2,(H,12,13,14);3-4H,1-2H2 |
| InChIKey | BZFABXUZSKZZNL-UHFFFAOYSA-N |
| XLogP | -1.61 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | -1.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|