C16H34N4O7S2 — CID 91431327
2-[4-[2-[2-[4-(2-hydroxyethyl)piperazin-1-yl]ethylsulfonyloxy]ethyl]piperazin-1-yl]ethanesulfonic acid (PubChem CID 91431327) has the molecular formula C16H34N4O7S2 and a molecular weight of 458.60 g/mol. Its IUPAC name is 2-[4-[2-[2-[4-(2-hydroxyethyl)piperazin-1-yl]ethylsulfonyloxy]ethyl]piperazin-1-yl]ethanesulfonic acid.
| Compound Name | 2-[4-[2-[2-[4-(2-hydroxyethyl)piperazin-1-yl]ethylsulfonyloxy]ethyl]piperazin-1-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 91431327 |
| Molecular Formula | C16H34N4O7S2 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | 2-[4-[2-[2-[4-(2-hydroxyethyl)piperazin-1-yl]ethylsulfonyloxy]ethyl]piperazin-1-yl]ethanesulfonic acid |
| SMILES | O=S(=O)(O)CCN1CCN(CCOS(=O)(=O)CCN2CCN(CCO)CC2)CC1 |
| InChI | InChI=1S/C16H34N4O7S2/c21-13-9-17-1-5-20(6-2-17)12-16-29(25,26)27-14-10-18-3-7-19(8-4-18)11-15-28(22,23)24/h21H,1-16H2,(H,22,23,24) |
| InChIKey | LYFGNEOVNKFMOK-UHFFFAOYSA-N |
| XLogP | -2.55 |
| TPSA | 130.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | -2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|