C8H18K2N2O6S2 — CID 88531629
CID 88531629 (PubChem CID 88531629) has the molecular formula C8H18K2N2O6S2 and a molecular weight of 380.57 g/mol.
| Compound Name | CID 88531629 |
|---|---|
| PubChem CID | 88531629 |
| Molecular Formula | C8H18K2N2O6S2 |
| Molecular Weight | 380.57 g/mol |
| Exact Mass | 379.99 |
| IUPAC Name | — |
| SMILES | O=S(=O)(O)CCN1CCN(CCS(=O)(=O)O)CC1.[K].[K] |
| InChI | InChI=1S/C8H18N2O6S2.2K/c11-17(12,13)7-5-9-1-2-10(4-3-9)6-8-18(14,15)16;;/h1-8H2,(H,11,12,13)(H,14,15,16);; |
| InChIKey | DNLXXYLROGDERC-UHFFFAOYSA-N |
| XLogP | -2.38 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.57 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|