C8H19N2NaO4S — CID 174954120
sodium;2-(4-ethoxypiperazin-1-yl)ethanesulfonic acid;hydride (PubChem CID 174954120) has the molecular formula C8H19N2NaO4S and a molecular weight of 262.31 g/mol. Its IUPAC name is sodium;2-(4-ethoxypiperazin-1-yl)ethanesulfonic acid;hydride.
| Compound Name | sodium;2-(4-ethoxypiperazin-1-yl)ethanesulfonic acid;hydride |
|---|---|
| PubChem CID | 174954120 |
| Molecular Formula | C8H19N2NaO4S |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | sodium;2-(4-ethoxypiperazin-1-yl)ethanesulfonic acid;hydride |
| SMILES | CCON1CCN(CCS(=O)(=O)O)CC1.[H-].[Na+] |
| InChI | InChI=1S/C8H18N2O4S.Na.H/c1-2-14-10-5-3-9(4-6-10)7-8-15(11,12)13;;/h2-8H2,1H3,(H,11,12,13);;/q;+1;-1 |
| InChIKey | NDVFGLKVURCSLX-UHFFFAOYSA-N |
| XLogP | -3.44 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | -3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|