C8H22N4O6S2 — CID 21484546
hydrazine;2-[4-(2-sulfoethyl)piperazin-1-yl]ethanesulfonic acid (PubChem CID 21484546) has the molecular formula C8H22N4O6S2 and a molecular weight of 334.42 g/mol. Its IUPAC name is hydrazine;2-[4-(2-sulfoethyl)piperazin-1-yl]ethanesulfonic acid.
| Compound Name | hydrazine;2-[4-(2-sulfoethyl)piperazin-1-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 21484546 |
| Molecular Formula | C8H22N4O6S2 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | hydrazine;2-[4-(2-sulfoethyl)piperazin-1-yl]ethanesulfonic acid |
| SMILES | NN.O=S(=O)(O)CCN1CCN(CCS(=O)(=O)O)CC1 |
| InChI | InChI=1S/C8H18N2O6S2.H4N2/c11-17(12,13)7-5-9-1-2-10(4-3-9)6-8-18(14,15)16;1-2/h1-8H2,(H,11,12,13)(H,14,15,16);1-2H2 |
| InChIKey | DXFAHBAJOQFQOG-UHFFFAOYSA-N |
| XLogP | -2.80 |
| TPSA | 167.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | -2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|