C9H16N2O6S — CID 2051309
3-oxo-3-[4-(2-sulfoethyl)piperazin-1-yl]propanoic acid (PubChem CID 2051309) has the molecular formula C9H16N2O6S and a molecular weight of 280.30 g/mol. Its IUPAC name is 3-oxo-3-[4-(2-sulfoethyl)piperazin-1-yl]propanoic acid.
| Compound Name | 3-oxo-3-[4-(2-sulfoethyl)piperazin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 2051309 |
| Molecular Formula | C9H16N2O6S |
| Molecular Weight | 280.30 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | 3-oxo-3-[4-(2-sulfoethyl)piperazin-1-yl]propanoic acid |
| SMILES | O=C(O)CC(=O)N1CCN(CCS(=O)(=O)O)CC1 |
| InChI | InChI=1S/C9H16N2O6S/c12-8(7-9(13)14)11-3-1-10(2-4-11)5-6-18(15,16)17/h1-7H2,(H,13,14)(H,15,16,17) |
| InChIKey | AICGDFPBOORIIF-UHFFFAOYSA-N |
| XLogP | -1.51 |
| TPSA | 115.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.30 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|