C14H31N3O8S2 — CID 87217926
2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid;2-morpholin-4-ylethanesulfonic acid (PubChem CID 87217926) has the molecular formula C14H31N3O8S2 and a molecular weight of 433.55 g/mol. Its IUPAC name is 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid;2-morpholin-4-ylethanesulfonic acid.
| Compound Name | 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid;2-morpholin-4-ylethanesulfonic acid |
|---|---|
| PubChem CID | 87217926 |
| Molecular Formula | C14H31N3O8S2 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid;2-morpholin-4-ylethanesulfonic acid |
| SMILES | O=S(=O)(O)CCN1CCN(CCO)CC1.O=S(=O)(O)CCN1CCOCC1 |
| InChI | InChI=1S/C8H18N2O4S.C6H13NO4S/c11-7-5-9-1-3-10(4-2-9)6-8-15(12,13)14;8-12(9,10)6-3-7-1-4-11-5-2-7/h11H,1-8H2,(H,12,13,14);1-6H2,(H,8,9,10) |
| InChIKey | MOSMAIBAOSWGAN-UHFFFAOYSA-N |
| XLogP | -2.31 |
| TPSA | 147.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | -2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|