C8H20Cl2N2O4S — CID 172776492
2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid;dihydrochloride (PubChem CID 172776492) has the molecular formula C8H20Cl2N2O4S and a molecular weight of 311.23 g/mol. Its IUPAC name is 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid;dihydrochloride.
| Compound Name | 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid;dihydrochloride |
|---|---|
| PubChem CID | 172776492 |
| Molecular Formula | C8H20Cl2N2O4S |
| Molecular Weight | 311.23 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | 2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid;dihydrochloride |
| SMILES | Cl.Cl.O=S(=O)(O)CCN1CCN(CCO)CC1 |
| InChI | InChI=1S/C8H18N2O4S.2ClH/c11-7-5-9-1-3-10(4-2-9)6-8-15(12,13)14;;/h11H,1-8H2,(H,12,13,14);2*1H |
| InChIKey | NQXGVFOERJPARR-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 81.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.23 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|