C8H19N2NaO5S — CID 71308703
sodium;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonate;hydrate (PubChem CID 71308703) has the molecular formula C8H19N2NaO5S and a molecular weight of 278.31 g/mol. Its IUPAC name is sodium;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonate;hydrate.
| Compound Name | sodium;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonate;hydrate |
|---|---|
| PubChem CID | 71308703 |
| Molecular Formula | C8H19N2NaO5S |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | sodium;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonate;hydrate |
| SMILES | O.O=S(=O)([O-])CCN1CCN(CCO)CC1.[Na+] |
| InChI | InChI=1S/C8H18N2O4S.Na.H2O/c11-7-5-9-1-3-10(4-2-9)6-8-15(12,13)14;;/h11H,1-8H2,(H,12,13,14);;1H2/q;+1;/p-1 |
| InChIKey | ZNJHFNUEQDVFCJ-UHFFFAOYSA-M |
| XLogP | -5.68 |
| TPSA | 115.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | -5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|