C16H34N4NaO8S2- — CID 127258879
sodium bis(2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonate) (PubChem CID 127258879) has the molecular formula C16H34N4NaO8S2- and a molecular weight of 497.59 g/mol. Its IUPAC name is sodium bis(2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonate).
| Compound Name | sodium bis(2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonate) |
|---|---|
| PubChem CID | 127258879 |
| Molecular Formula | C16H34N4NaO8S2- |
| Molecular Weight | 497.59 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | sodium bis(2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonate) |
| SMILES | O=S(=O)([O-])CCN1CCN(CCO)CC1.O=S(=O)([O-])CCN1CCN(CCO)CC1.[Na+] |
| InChI | InChI=1S/2C8H18N2O4S.Na/c2*11-7-5-9-1-3-10(4-2-9)6-8-15(12,13)14;/h2*11H,1-8H2,(H,12,13,14);/q;;+1/p-2 |
| InChIKey | KJICBABKQWYBFV-UHFFFAOYSA-L |
| XLogP | -6.71 |
| TPSA | 167.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.59 |
| LogP ≤ 5 | -6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|