C10H22N2O6S — CID 162316861
acetic acid;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid (PubChem CID 162316861) has the molecular formula C10H22N2O6S and a molecular weight of 298.36 g/mol. Its IUPAC name is acetic acid;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid.
| Compound Name | acetic acid;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid |
|---|---|
| PubChem CID | 162316861 |
| Molecular Formula | C10H22N2O6S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | acetic acid;2-[4-(2-hydroxyethyl)piperazin-1-yl]ethanesulfonic acid |
| SMILES | CC(=O)O.O=S(=O)(O)CCN1CCN(CCO)CC1 |
| InChI | InChI=1S/C8H18N2O4S.C2H4O2/c11-7-5-9-1-3-10(4-2-9)6-8-15(12,13)14;1-2(3)4/h11H,1-8H2,(H,12,13,14);1H3,(H,3,4) |
| InChIKey | UBLIGIPQYUKWOQ-UHFFFAOYSA-N |
| XLogP | -1.42 |
| TPSA | 118.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|