C6H13N2NaO4S — CID 140638912
sodium 2-(4-hydroxypiperazin-1-yl)ethanesulfonate (PubChem CID 140638912) has the molecular formula C6H13N2NaO4S and a molecular weight of 232.24 g/mol. Its IUPAC name is sodium 2-(4-hydroxypiperazin-1-yl)ethanesulfonate.
| Compound Name | sodium 2-(4-hydroxypiperazin-1-yl)ethanesulfonate |
|---|---|
| PubChem CID | 140638912 |
| Molecular Formula | C6H13N2NaO4S |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | sodium 2-(4-hydroxypiperazin-1-yl)ethanesulfonate |
| SMILES | O=S(=O)([O-])CCN1CCN(O)CC1.[Na+] |
| InChI | InChI=1S/C6H14N2O4S.Na/c9-8-3-1-7(2-4-8)5-6-13(10,11)12;/h9H,1-6H2,(H,10,11,12);/q;+1/p-1 |
| InChIKey | VAJZKNYUXQGHAM-UHFFFAOYSA-M |
| XLogP | -4.46 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | -4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|