About sodium;3-morpholin-4-ylpropane-1-sulfonate;hydrate
sodium;3-morpholin-4-ylpropane-1-sulfonate;hydrate (PubChem CID 43833364) has the molecular formula C7H16NNaO5S
and a molecular weight of 249.26 g/mol. Its IUPAC name is sodium;3-morpholin-4-ylpropane-1-sulfonate;hydrate.
Molecular Properties
| Compound Name | sodium;3-morpholin-4-ylpropane-1-sulfonate;hydrate |
| PubChem CID | 43833364 |
| Molecular Formula | C7H16NNaO5S |
| Molecular Weight | 249.26 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | sodium;3-morpholin-4-ylpropane-1-sulfonate;hydrate |
| SMILES | O.O=S(=O)([O-])CCCN1CCOCC1.[Na+] |
| InChI | InChI=1S/C7H15NO4S.Na.H2O/c9-13(10,11)7-1-2-8-3-5-12-6-4-8;;/h1-7H2,(H,9,10,11);;1H2/q;+1;/p-1 |
| InChIKey | ZEDAGFBWUVYFQU-UHFFFAOYSA-M |
| XLogP | -4.57 |
| TPSA | 101.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.26 |
| LogP ≤ 5 | -4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;3-morpholin-4-ylpropane-1-sulfonate;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;3-morpholin-4-ylpropane-1-sulfonate;hydrate?
The IUPAC name of sodium;3-morpholin-4-ylpropane-1-sulfonate;hydrate (CID 43833364) is sodium;3-morpholin-4-ylpropane-1-sulfonate;hydrate.
What is the SMILES notation for sodium;3-morpholin-4-ylpropane-1-sulfonate;hydrate?
The canonical SMILES for sodium;3-morpholin-4-ylpropane-1-sulfonate;hydrate is O.O=S(=O)([O-])CCCN1CCOCC1.[Na+].
What is the InChIKey of sodium;3-morpholin-4-ylpropane-1-sulfonate;hydrate?
The InChIKey is ZEDAGFBWUVYFQU-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H15NO4S.Na.H2O/c9-13(10,11)7-1-2-8-3-5-12-6-4-8;;/h1-7H2,(H,9,10,11);;1H2/q;+1;/p-1.
What are the key properties of sodium;3-morpholin-4-ylpropane-1-sulfonate;hydrate?
sodium;3-morpholin-4-ylpropane-1-sulfonate;hydrate has a molecular weight of 249.26 g/mol, XLogP of -4.57, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;3-morpholin-4-ylpropane-1-sulfonate;hydrate is sourced from PubChem (CID 43833364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).