About propylsulfonyl 3-morpholin-4-ylpropane-1-sulfonate
propylsulfonyl 3-morpholin-4-ylpropane-1-sulfonate (PubChem CID 175290511) has the molecular formula C10H21NO6S2
and a molecular weight of 315.41 g/mol. Its IUPAC name is propylsulfonyl 3-morpholin-4-ylpropane-1-sulfonate.
Molecular Properties
| Compound Name | propylsulfonyl 3-morpholin-4-ylpropane-1-sulfonate |
| PubChem CID | 175290511 |
| Molecular Formula | C10H21NO6S2 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.08 |
| IUPAC Name | propylsulfonyl 3-morpholin-4-ylpropane-1-sulfonate |
| SMILES | CCCS(=O)(=O)OS(=O)(=O)CCCN1CCOCC1 |
| InChI | InChI=1S/C10H21NO6S2/c1-2-9-18(12,13)17-19(14,15)10-3-4-11-5-7-16-8-6-11/h2-10H2,1H3 |
| InChIKey | DZWCYXLCOSZKOC-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze propylsulfonyl 3-morpholin-4-ylpropane-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propylsulfonyl 3-morpholin-4-ylpropane-1-sulfonate?
The IUPAC name of propylsulfonyl 3-morpholin-4-ylpropane-1-sulfonate (CID 175290511) is propylsulfonyl 3-morpholin-4-ylpropane-1-sulfonate.
What is the SMILES notation for propylsulfonyl 3-morpholin-4-ylpropane-1-sulfonate?
The canonical SMILES for propylsulfonyl 3-morpholin-4-ylpropane-1-sulfonate is CCCS(=O)(=O)OS(=O)(=O)CCCN1CCOCC1.
What is the InChIKey of propylsulfonyl 3-morpholin-4-ylpropane-1-sulfonate?
The InChIKey is DZWCYXLCOSZKOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO6S2/c1-2-9-18(12,13)17-19(14,15)10-3-4-11-5-7-16-8-6-11/h2-10H2,1H3.
What are the key properties of propylsulfonyl 3-morpholin-4-ylpropane-1-sulfonate?
propylsulfonyl 3-morpholin-4-ylpropane-1-sulfonate has a molecular weight of 315.41 g/mol, XLogP of -0.21, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for propylsulfonyl 3-morpholin-4-ylpropane-1-sulfonate is sourced from PubChem (CID 175290511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).