About 3-piperidin-1-ylpropane-1-sulfonate;tetraethylazanium
3-piperidin-1-ylpropane-1-sulfonate;tetraethylazanium (PubChem CID 56973044) has the molecular formula C16H36N2O3S
and a molecular weight of 336.54 g/mol. Its IUPAC name is 3-piperidin-1-ylpropane-1-sulfonate;tetraethylazanium.
Molecular Properties
| Compound Name | 3-piperidin-1-ylpropane-1-sulfonate;tetraethylazanium |
| PubChem CID | 56973044 |
| Molecular Formula | C16H36N2O3S |
| Molecular Weight | 336.54 g/mol |
| Exact Mass | 336.24 |
| IUPAC Name | 3-piperidin-1-ylpropane-1-sulfonate;tetraethylazanium |
| SMILES | CC[N+](CC)(CC)CC.O=S(=O)([O-])CCCN1CCCCC1 |
| InChI | InChI=1S/C8H17NO3S.C8H20N/c10-13(11,12)8-4-7-9-5-2-1-3-6-9;1-5-9(6-2,7-3)8-4/h1-8H2,(H,10,11,12);5-8H2,1-4H3/q;+1/p-1 |
| InChIKey | XROFRWWSOCNPGW-UHFFFAOYSA-M |
| XLogP | 2.29 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.54 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-piperidin-1-ylpropane-1-sulfonate;tetraethylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-piperidin-1-ylpropane-1-sulfonate;tetraethylazanium?
The IUPAC name of 3-piperidin-1-ylpropane-1-sulfonate;tetraethylazanium (CID 56973044) is 3-piperidin-1-ylpropane-1-sulfonate;tetraethylazanium.
What is the SMILES notation for 3-piperidin-1-ylpropane-1-sulfonate;tetraethylazanium?
The canonical SMILES for 3-piperidin-1-ylpropane-1-sulfonate;tetraethylazanium is CC[N+](CC)(CC)CC.O=S(=O)([O-])CCCN1CCCCC1.
What is the InChIKey of 3-piperidin-1-ylpropane-1-sulfonate;tetraethylazanium?
The InChIKey is XROFRWWSOCNPGW-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H17NO3S.C8H20N/c10-13(11,12)8-4-7-9-5-2-1-3-6-9;1-5-9(6-2,7-3)8-4/h1-8H2,(H,10,11,12);5-8H2,1-4H3/q;+1/p-1.
What are the key properties of 3-piperidin-1-ylpropane-1-sulfonate;tetraethylazanium?
3-piperidin-1-ylpropane-1-sulfonate;tetraethylazanium has a molecular weight of 336.54 g/mol, XLogP of 2.29, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-piperidin-1-ylpropane-1-sulfonate;tetraethylazanium is sourced from PubChem (CID 56973044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).