About hydron;2-(triethylazaniumyl)ethanesulfonate
hydron;2-(triethylazaniumyl)ethanesulfonate (PubChem CID 101285365) has the molecular formula C8H20NO3S+
and a molecular weight of 210.32 g/mol. Its IUPAC name is hydron;2-(triethylazaniumyl)ethanesulfonate.
Molecular Properties
| Compound Name | hydron;2-(triethylazaniumyl)ethanesulfonate |
| PubChem CID | 101285365 |
| Molecular Formula | C8H20NO3S+ |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | hydron;2-(triethylazaniumyl)ethanesulfonate |
| SMILES | CC[N+](CC)(CC)CCS(=O)(=O)[O-].[H+] |
| InChI | InChI=1S/C8H19NO3S/c1-4-9(5-2,6-3)7-8-13(10,11)12/h4-8H2,1-3H3/p+1 |
| InChIKey | FSBKBPNHVHWRBJ-UHFFFAOYSA-O |
| XLogP | 0.52 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze hydron;2-(triethylazaniumyl)ethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydron;2-(triethylazaniumyl)ethanesulfonate?
The IUPAC name of hydron;2-(triethylazaniumyl)ethanesulfonate (CID 101285365) is hydron;2-(triethylazaniumyl)ethanesulfonate.
What is the SMILES notation for hydron;2-(triethylazaniumyl)ethanesulfonate?
The canonical SMILES for hydron;2-(triethylazaniumyl)ethanesulfonate is CC[N+](CC)(CC)CCS(=O)(=O)[O-].[H+].
What is the InChIKey of hydron;2-(triethylazaniumyl)ethanesulfonate?
The InChIKey is FSBKBPNHVHWRBJ-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H19NO3S/c1-4-9(5-2,6-3)7-8-13(10,11)12/h4-8H2,1-3H3/p+1.
What are the key properties of hydron;2-(triethylazaniumyl)ethanesulfonate?
hydron;2-(triethylazaniumyl)ethanesulfonate has a molecular weight of 210.32 g/mol, XLogP of 0.52, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydron;2-(triethylazaniumyl)ethanesulfonate is sourced from PubChem (CID 101285365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).