About 2-(diethylamino)ethyl-triethylazanium;methane;methanesulfonate
2-(diethylamino)ethyl-triethylazanium;methane;methanesulfonate (PubChem CID 161284822) has the molecular formula C14H36N2O3S
and a molecular weight of 312.52 g/mol. Its IUPAC name is 2-(diethylamino)ethyl-triethylazanium;methane;methanesulfonate.
Molecular Properties
| Compound Name | 2-(diethylamino)ethyl-triethylazanium;methane;methanesulfonate |
| PubChem CID | 161284822 |
| Molecular Formula | C14H36N2O3S |
| Molecular Weight | 312.52 g/mol |
| Exact Mass | 312.24 |
| IUPAC Name | 2-(diethylamino)ethyl-triethylazanium;methane;methanesulfonate |
| SMILES | C.CCN(CC)CC[N+](CC)(CC)CC.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C12H29N2.CH4O3S.CH4/c1-6-13(7-2)11-12-14(8-3,9-4)10-5;1-5(2,3)4;/h6-12H2,1-5H3;1H3,(H,2,3,4);1H4/q+1;;/p-1 |
| InChIKey | YGXAHOANMPFGPT-UHFFFAOYSA-M |
| XLogP | 2.00 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.52 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(diethylamino)ethyl-triethylazanium;methane;methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethyl-triethylazanium;methane;methanesulfonate?
The IUPAC name of 2-(diethylamino)ethyl-triethylazanium;methane;methanesulfonate (CID 161284822) is 2-(diethylamino)ethyl-triethylazanium;methane;methanesulfonate.
What is the SMILES notation for 2-(diethylamino)ethyl-triethylazanium;methane;methanesulfonate?
The canonical SMILES for 2-(diethylamino)ethyl-triethylazanium;methane;methanesulfonate is C.CCN(CC)CC[N+](CC)(CC)CC.CS(=O)(=O)[O-].
What is the InChIKey of 2-(diethylamino)ethyl-triethylazanium;methane;methanesulfonate?
The InChIKey is YGXAHOANMPFGPT-UHFFFAOYSA-M. The full InChI is InChI=1S/C12H29N2.CH4O3S.CH4/c1-6-13(7-2)11-12-14(8-3,9-4)10-5;1-5(2,3)4;/h6-12H2,1-5H3;1H3,(H,2,3,4);1H4/q+1;;/p-1.
What are the key properties of 2-(diethylamino)ethyl-triethylazanium;methane;methanesulfonate?
2-(diethylamino)ethyl-triethylazanium;methane;methanesulfonate has a molecular weight of 312.52 g/mol, XLogP of 2.00, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethyl-triethylazanium;methane;methanesulfonate is sourced from PubChem (CID 161284822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).