C14H36N2O3S — CID 161284822
2-(diethylamino)ethyl-triethylazanium;methane;methanesulfonate (PubChem CID 161284822) has the molecular formula C14H36N2O3S and a molecular weight of 312.52 g/mol. Its IUPAC name is 2-(diethylamino)ethyl-triethylazanium;methane;methanesulfonate.
| Compound Name | 2-(diethylamino)ethyl-triethylazanium;methane;methanesulfonate |
|---|---|
| PubChem CID | 161284822 |
| Molecular Formula | C14H36N2O3S |
| Molecular Weight | 312.52 g/mol |
| Exact Mass | 312.24 |
| IUPAC Name | 2-(diethylamino)ethyl-triethylazanium;methane;methanesulfonate |
| SMILES | C.CCN(CC)CC[N+](CC)(CC)CC.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C12H29N2.CH4O3S.CH4/c1-6-13(7-2)11-12-14(8-3,9-4)10-5;1-5(2,3)4;/h6-12H2,1-5H3;1H3,(H,2,3,4);1H4/q+1;;/p-1 |
| InChIKey | YGXAHOANMPFGPT-UHFFFAOYSA-M |
| XLogP | 2.00 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.52 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|