C7H20N4O4S — CID 135506204
[amino(azaniumylidene)methyl]-[2-(diethylamino)ethyl]azanium sulfate (PubChem CID 135506204) has the molecular formula C7H20N4O4S and a molecular weight of 256.33 g/mol. Its IUPAC name is [amino(azaniumylidene)methyl]-[2-(diethylamino)ethyl]azanium sulfate.
| Compound Name | [amino(azaniumylidene)methyl]-[2-(diethylamino)ethyl]azanium sulfate |
|---|---|
| PubChem CID | 135506204 |
| Molecular Formula | C7H20N4O4S |
| Molecular Weight | 256.33 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | [amino(azaniumylidene)methyl]-[2-(diethylamino)ethyl]azanium sulfate |
| SMILES | CCN(CC)CC[NH2+]C(N)=[NH2+].O=S(=O)([O-])[O-] |
| InChI | InChI=1S/C7H18N4.H2O4S/c1-3-11(4-2)6-5-10-7(8)9;1-5(2,3)4/h3-6H2,1-2H3,(H4,8,9,10);(H2,1,2,3,4) |
| InChIKey | WNPCZRJBOPAEFM-UHFFFAOYSA-N |
| XLogP | -4.37 |
| TPSA | 151.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.33 |
| LogP ≤ 5 | -4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|