C10H23AuN2O2 — CID 87289992
N',N'-diethylethane-1,2-diamine;gold(1+);2-methylpropanoate (PubChem CID 87289992) has the molecular formula C10H23AuN2O2 and a molecular weight of 400.27 g/mol. Its IUPAC name is N',N'-diethylethane-1,2-diamine;gold(1+);2-methylpropanoate.
| Compound Name | N',N'-diethylethane-1,2-diamine;gold(1+);2-methylpropanoate |
|---|---|
| PubChem CID | 87289992 |
| Molecular Formula | C10H23AuN2O2 |
| Molecular Weight | 400.27 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | N',N'-diethylethane-1,2-diamine;gold(1+);2-methylpropanoate |
| SMILES | CC(C)C(=O)[O-].CCN(CC)CCN.[Au+] |
| InChI | InChI=1S/C6H16N2.C4H8O2.Au/c1-3-8(4-2)6-5-7;1-3(2)4(5)6;/h3-7H2,1-2H3;3H,1-2H3,(H,5,6);/q;;+1/p-1 |
| InChIKey | BRBJTDWYMYMUQK-UHFFFAOYSA-M |
| XLogP | -0.32 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.27 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |