About 3-(diethylamino)propyl 2-methylpropanoate
3-(diethylamino)propyl 2-methylpropanoate (PubChem CID 58333619) has the molecular formula C11H23NO2
and a molecular weight of 201.31 g/mol. Its IUPAC name is 3-(diethylamino)propyl 2-methylpropanoate.
Molecular Properties
| Compound Name | 3-(diethylamino)propyl 2-methylpropanoate |
| PubChem CID | 58333619 |
| Molecular Formula | C11H23NO2 |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.17 |
| IUPAC Name | 3-(diethylamino)propyl 2-methylpropanoate |
| SMILES | CCN(CC)CCCOC(=O)C(C)C |
| InChI | InChI=1S/C11H23NO2/c1-5-12(6-2)8-7-9-14-11(13)10(3)4/h10H,5-9H2,1-4H3 |
| InChIKey | COIPGTMMAVQZGA-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-(diethylamino)propyl 2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(diethylamino)propyl 2-methylpropanoate?
The IUPAC name of 3-(diethylamino)propyl 2-methylpropanoate (CID 58333619) is 3-(diethylamino)propyl 2-methylpropanoate.
What is the SMILES notation for 3-(diethylamino)propyl 2-methylpropanoate?
The canonical SMILES for 3-(diethylamino)propyl 2-methylpropanoate is CCN(CC)CCCOC(=O)C(C)C.
What is the InChIKey of 3-(diethylamino)propyl 2-methylpropanoate?
The InChIKey is COIPGTMMAVQZGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO2/c1-5-12(6-2)8-7-9-14-11(13)10(3)4/h10H,5-9H2,1-4H3.
What are the key properties of 3-(diethylamino)propyl 2-methylpropanoate?
3-(diethylamino)propyl 2-methylpropanoate has a molecular weight of 201.31 g/mol, XLogP of 1.92, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(diethylamino)propyl 2-methylpropanoate is sourced from PubChem (CID 58333619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).