About 3-(diethylamino)propyl 2-methylbut-2-enoate
3-(diethylamino)propyl 2-methylbut-2-enoate (PubChem CID 150789406) has the molecular formula C12H23NO2
and a molecular weight of 213.32 g/mol. Its IUPAC name is 3-(diethylamino)propyl 2-methylbut-2-enoate.
Molecular Properties
| Compound Name | 3-(diethylamino)propyl 2-methylbut-2-enoate |
| PubChem CID | 150789406 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | 3-(diethylamino)propyl 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OCCCN(CC)CC |
| InChI | InChI=1S/C12H23NO2/c1-5-11(4)12(14)15-10-8-9-13(6-2)7-3/h5H,6-10H2,1-4H3 |
| InChIKey | KDNKFLSZDRTUBB-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-(diethylamino)propyl 2-methylbut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(diethylamino)propyl 2-methylbut-2-enoate?
The IUPAC name of 3-(diethylamino)propyl 2-methylbut-2-enoate (CID 150789406) is 3-(diethylamino)propyl 2-methylbut-2-enoate.
What is the SMILES notation for 3-(diethylamino)propyl 2-methylbut-2-enoate?
The canonical SMILES for 3-(diethylamino)propyl 2-methylbut-2-enoate is CC=C(C)C(=O)OCCCN(CC)CC.
What is the InChIKey of 3-(diethylamino)propyl 2-methylbut-2-enoate?
The InChIKey is KDNKFLSZDRTUBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23NO2/c1-5-11(4)12(14)15-10-8-9-13(6-2)7-3/h5H,6-10H2,1-4H3.
What are the key properties of 3-(diethylamino)propyl 2-methylbut-2-enoate?
3-(diethylamino)propyl 2-methylbut-2-enoate has a molecular weight of 213.32 g/mol, XLogP of 2.23, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(diethylamino)propyl 2-methylbut-2-enoate is sourced from PubChem (CID 150789406), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).