2-[2-aminoethyl(ethyl)amino]acetic acid

C6H14N2O2 — CID 22667567

IUPAC2-[2-aminoethyl(ethyl)amino]acetic acid
SMILESCCN(CCN)CC(=O)O
InChIInChI=1S/C6H14N2O2/c1-2-8(4-3-7)5-6(9)10/h2-5,7H2,1H3,(H,9,10)
InChIKeyOECIDZZGUZGWNV-UHFFFAOYSA-N
MW146.19 g/mol
LogP-0.65
Rot. Bonds5

About 2-[2-aminoethyl(ethyl)amino]acetic acid

2-[2-aminoethyl(ethyl)amino]acetic acid (PubChem CID 22667567) has the molecular formula C6H14N2O2 and a molecular weight of 146.19 g/mol. Its IUPAC name is 2-[2-aminoethyl(ethyl)amino]acetic acid.

Molecular Properties

Compound Name2-[2-aminoethyl(ethyl)amino]acetic acid
PubChem CID22667567
Molecular FormulaC6H14N2O2
Molecular Weight146.19 g/mol
Exact Mass146.11
IUPAC Name2-[2-aminoethyl(ethyl)amino]acetic acid
SMILESCCN(CCN)CC(=O)O
InChIInChI=1S/C6H14N2O2/c1-2-8(4-3-7)5-6(9)10/h2-5,7H2,1H3,(H,9,10)
InChIKeyOECIDZZGUZGWNV-UHFFFAOYSA-N
XLogP-0.65
TPSA66.56 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds5
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500146.19
LogP ≤ 5-0.65
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-[2-aminoethyl(ethyl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-[bis(2-aminoethyl)amino]acetic acid
CID 15523358
2-[bis(2-aminoethyl)amino]acetic acid;hydrochloride
CID 86150620
acetic acid;N',N'-diethylethane-1,2-diamine
CID 175226296
ethane;2-[ethyl(propyl)amino]acetic acid
CID 143677754
2-[2-aminoethyl-[2-(dimethylamino)ethyl]amino]acetic acid
CID 107425136
2-[ethyl-[2-[ethyl(2-oxopropyl)amino]ethyl]amino]acetic acid
CID 134601961
bis(4-[bis(carboxymethyl)amino]butanoic acid);2-[2-[carboxymethyl(ethyl)amino]ethyl-ethylamino]acetic acid;ethanamine
CID 173160493
methyl 2-[2-[2-aminoethyl-(2-methoxy-2-oxoethyl)amino]ethyl-ethylamino]acetate
CID 155041284
2-[2-[carboxymethyl-(2-ethoxy-2-oxoethyl)amino]ethyl-[2-[(2-ethoxy-2-oxoethyl)-ethylamino]ethyl]amino]acetic acid
CID 156509209
2-[3-aminopropyl(propyl)amino]acetic acid
CID 63652854
2-[bis(3-aminopropyl)amino]acetic acid
CID 15799499
2-[[3-(carbamoylamino)-3-oxopropyl]-ethylamino]acetic acid
CID 61011603

Frequently Asked Questions

What is the IUPAC name of 2-[2-aminoethyl(ethyl)amino]acetic acid?
The IUPAC name of 2-[2-aminoethyl(ethyl)amino]acetic acid (CID 22667567) is 2-[2-aminoethyl(ethyl)amino]acetic acid.
What is the SMILES notation for 2-[2-aminoethyl(ethyl)amino]acetic acid?
The canonical SMILES for 2-[2-aminoethyl(ethyl)amino]acetic acid is CCN(CCN)CC(=O)O.
What is the InChIKey of 2-[2-aminoethyl(ethyl)amino]acetic acid?
The InChIKey is OECIDZZGUZGWNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14N2O2/c1-2-8(4-3-7)5-6(9)10/h2-5,7H2,1H3,(H,9,10).
What are the key properties of 2-[2-aminoethyl(ethyl)amino]acetic acid?
2-[2-aminoethyl(ethyl)amino]acetic acid has a molecular weight of 146.19 g/mol, XLogP of -0.65, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-aminoethyl(ethyl)amino]acetic acid is sourced from PubChem (CID 22667567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).