C7H20ClNO3S — CID 87836130
N,N-diethylethanamine;methanesulfonic acid;hydrochloride (PubChem CID 87836130) has the molecular formula C7H20ClNO3S and a molecular weight of 233.76 g/mol. Its IUPAC name is N,N-diethylethanamine;methanesulfonic acid;hydrochloride.
| Compound Name | N,N-diethylethanamine;methanesulfonic acid;hydrochloride |
|---|---|
| PubChem CID | 87836130 |
| Molecular Formula | C7H20ClNO3S |
| Molecular Weight | 233.76 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | N,N-diethylethanamine;methanesulfonic acid;hydrochloride |
| SMILES | CCN(CC)CC.CS(=O)(=O)O.Cl |
| InChI | InChI=1S/C6H15N.CH4O3S.ClH/c1-4-7(5-2)6-3;1-5(2,3)4;/h4-6H2,1-3H3;1H3,(H,2,3,4);1H |
| InChIKey | XQTXFJMTOQYXOI-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.76 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|