C10H26N2O3S — CID 175940387
N,N-diethylethanamine;2-(dimethylamino)ethanesulfonic acid (PubChem CID 175940387) has the molecular formula C10H26N2O3S and a molecular weight of 254.40 g/mol. Its IUPAC name is N,N-diethylethanamine;2-(dimethylamino)ethanesulfonic acid.
| Compound Name | N,N-diethylethanamine;2-(dimethylamino)ethanesulfonic acid |
|---|---|
| PubChem CID | 175940387 |
| Molecular Formula | C10H26N2O3S |
| Molecular Weight | 254.40 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | N,N-diethylethanamine;2-(dimethylamino)ethanesulfonic acid |
| SMILES | CCN(CC)CC.CN(C)CCS(=O)(=O)O |
| InChI | InChI=1S/C6H15N.C4H11NO3S/c1-4-7(5-2)6-3;1-5(2)3-4-9(6,7)8/h4-6H2,1-3H3;3-4H2,1-2H3,(H,6,7,8) |
| InChIKey | OQSDHWYYOHEIFL-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.40 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|