C8H21NO3S — CID 173037314
N,N-dimethylpropan-1-amine;propane-1-sulfonic acid (PubChem CID 173037314) has the molecular formula C8H21NO3S and a molecular weight of 211.33 g/mol. Its IUPAC name is N,N-dimethylpropan-1-amine;propane-1-sulfonic acid.
| Compound Name | N,N-dimethylpropan-1-amine;propane-1-sulfonic acid |
|---|---|
| PubChem CID | 173037314 |
| Molecular Formula | C8H21NO3S |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | N,N-dimethylpropan-1-amine;propane-1-sulfonic acid |
| SMILES | CCCN(C)C.CCCS(=O)(=O)O |
| InChI | InChI=1S/C5H13N.C3H8O3S/c1-4-5-6(2)3;1-2-3-7(4,5)6/h4-5H2,1-3H3;2-3H2,1H3,(H,4,5,6) |
| InChIKey | YQRRQZASZVDIJJ-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|