About 2-(dimethylamino)ethanesulfonic acid;pentan-1-amine
2-(dimethylamino)ethanesulfonic acid;pentan-1-amine (PubChem CID 174855112) has the molecular formula C9H24N2O3S
and a molecular weight of 240.37 g/mol. Its IUPAC name is 2-(dimethylamino)ethanesulfonic acid;pentan-1-amine.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethanesulfonic acid;pentan-1-amine |
| PubChem CID | 174855112 |
| Molecular Formula | C9H24N2O3S |
| Molecular Weight | 240.37 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | 2-(dimethylamino)ethanesulfonic acid;pentan-1-amine |
| SMILES | CCCCCN.CN(C)CCS(=O)(=O)O |
| InChI | InChI=1S/C5H13N.C4H11NO3S/c1-2-3-4-5-6;1-5(2)3-4-9(6,7)8/h2-6H2,1H3;3-4H2,1-2H3,(H,6,7,8) |
| InChIKey | NWPAIMIZNZKUSW-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.37 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)ethanesulfonic acid;pentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethanesulfonic acid;pentan-1-amine?
The IUPAC name of 2-(dimethylamino)ethanesulfonic acid;pentan-1-amine (CID 174855112) is 2-(dimethylamino)ethanesulfonic acid;pentan-1-amine.
What is the SMILES notation for 2-(dimethylamino)ethanesulfonic acid;pentan-1-amine?
The canonical SMILES for 2-(dimethylamino)ethanesulfonic acid;pentan-1-amine is CCCCCN.CN(C)CCS(=O)(=O)O.
What is the InChIKey of 2-(dimethylamino)ethanesulfonic acid;pentan-1-amine?
The InChIKey is NWPAIMIZNZKUSW-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13N.C4H11NO3S/c1-2-3-4-5-6;1-5(2)3-4-9(6,7)8/h2-6H2,1H3;3-4H2,1-2H3,(H,6,7,8).
What are the key properties of 2-(dimethylamino)ethanesulfonic acid;pentan-1-amine?
2-(dimethylamino)ethanesulfonic acid;pentan-1-amine has a molecular weight of 240.37 g/mol, XLogP of 0.57, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethanesulfonic acid;pentan-1-amine is sourced from PubChem (CID 174855112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).