About aluminum;diaminomethylideneazanium;sulfate
aluminum;diaminomethylideneazanium;sulfate (PubChem CID 135853176) has the molecular formula CH6AlN3O4S+2
and a molecular weight of 183.12 g/mol. Its IUPAC name is aluminum;diaminomethylideneazanium;sulfate.
Molecular Properties
| Compound Name | aluminum;diaminomethylideneazanium;sulfate |
| PubChem CID | 135853176 |
| Molecular Formula | CH6AlN3O4S+2 |
| Molecular Weight | 183.12 g/mol |
| Exact Mass | 182.99 |
| IUPAC Name | aluminum;diaminomethylideneazanium;sulfate |
| SMILES | NC(N)=[NH2+].O=S(=O)([O-])[O-].[Al+3] |
| InChI | InChI=1S/CH5N3.Al.H2O4S/c2-1(3)4;;1-5(2,3)4/h(H5,2,3,4);;(H2,1,2,3,4)/q;+3;/p-1 |
| InChIKey | STHNAZDKVZOSLA-UHFFFAOYSA-M |
| XLogP | -4.70 |
| TPSA | 157.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.12 |
| LogP ≤ 5 | -4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze aluminum;diaminomethylideneazanium;sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aluminum;diaminomethylideneazanium;sulfate?
The IUPAC name of aluminum;diaminomethylideneazanium;sulfate (CID 135853176) is aluminum;diaminomethylideneazanium;sulfate.
What is the SMILES notation for aluminum;diaminomethylideneazanium;sulfate?
The canonical SMILES for aluminum;diaminomethylideneazanium;sulfate is NC(N)=[NH2+].O=S(=O)([O-])[O-].[Al+3].
What is the InChIKey of aluminum;diaminomethylideneazanium;sulfate?
The InChIKey is STHNAZDKVZOSLA-UHFFFAOYSA-M. The full InChI is InChI=1S/CH5N3.Al.H2O4S/c2-1(3)4;;1-5(2,3)4/h(H5,2,3,4);;(H2,1,2,3,4)/q;+3;/p-1.
What are the key properties of aluminum;diaminomethylideneazanium;sulfate?
aluminum;diaminomethylideneazanium;sulfate has a molecular weight of 183.12 g/mol, XLogP of -4.70, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for aluminum;diaminomethylideneazanium;sulfate is sourced from PubChem (CID 135853176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).