About azanium;urea;disulfate
azanium;urea;disulfate (PubChem CID 23111519) has the molecular formula CH8N3O9S2-3
and a molecular weight of 270.22 g/mol. Its IUPAC name is azanium;urea;disulfate.
Molecular Properties
| Compound Name | azanium;urea;disulfate |
| PubChem CID | 23111519 |
| Molecular Formula | CH8N3O9S2-3 |
| Molecular Weight | 270.22 g/mol |
| Exact Mass | 269.97 |
| IUPAC Name | azanium;urea;disulfate |
| SMILES | NC(N)=O.O=S(=O)([O-])[O-].O=S(=O)([O-])[O-].[NH4+] |
| InChI | InChI=1S/CH4N2O.H3N.2H2O4S/c2-1(3)4;;2*1-5(2,3)4/h(H4,2,3,4);1H3;2*(H2,1,2,3,4)/p-3 |
| InChIKey | JGNZOLMSMHGIED-UHFFFAOYSA-K |
| XLogP | -3.28 |
| TPSA | 266.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.22 |
| LogP ≤ 5 | -3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze azanium;urea;disulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium;urea;disulfate?
The IUPAC name of azanium;urea;disulfate (CID 23111519) is azanium;urea;disulfate.
What is the SMILES notation for azanium;urea;disulfate?
The canonical SMILES for azanium;urea;disulfate is NC(N)=O.O=S(=O)([O-])[O-].O=S(=O)([O-])[O-].[NH4+].
What is the InChIKey of azanium;urea;disulfate?
The InChIKey is JGNZOLMSMHGIED-UHFFFAOYSA-K. The full InChI is InChI=1S/CH4N2O.H3N.2H2O4S/c2-1(3)4;;2*1-5(2,3)4/h(H4,2,3,4);1H3;2*(H2,1,2,3,4)/p-3.
What are the key properties of azanium;urea;disulfate?
azanium;urea;disulfate has a molecular weight of 270.22 g/mol, XLogP of -3.28, 0 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for azanium;urea;disulfate is sourced from PubChem (CID 23111519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).