C27H65N5+4 — CID 59582702
2-(diethylamino)ethyl-[[2-[diethyl(methyl)azaniumyl]ethyl-ethyl-[2-(triethylazaniumyl)ethyl]azaniumyl]methyl]-ethyl-methylazanium (PubChem CID 59582702) has the molecular formula C27H65N5+4 and a molecular weight of 459.85 g/mol. Its IUPAC name is 2-(diethylamino)ethyl-[[2-[diethyl(methyl)azaniumyl]ethyl-ethyl-[2-(triethylazaniumyl)ethyl]azaniumyl]methyl]-ethyl-methylazanium.
| Compound Name | 2-(diethylamino)ethyl-[[2-[diethyl(methyl)azaniumyl]ethyl-ethyl-[2-(triethylazaniumyl)ethyl]azaniumyl]methyl]-ethyl-methylazanium |
|---|---|
| PubChem CID | 59582702 |
| Molecular Formula | C27H65N5+4 |
| Molecular Weight | 459.85 g/mol |
| Exact Mass | 459.52 |
| IUPAC Name | 2-(diethylamino)ethyl-[[2-[diethyl(methyl)azaniumyl]ethyl-ethyl-[2-(triethylazaniumyl)ethyl]azaniumyl]methyl]-ethyl-methylazanium |
| SMILES | CCN(CC)CC[N+](C)(CC)C[N+](CC)(CC[N+](C)(CC)CC)CC[N+](CC)(CC)CC |
| InChI | InChI=1S/C27H65N5/c1-12-28(13-2)21-22-30(11,16-5)27-32(20-9,24-23-29(10,14-3)15-4)26-25-31(17-6,18-7)19-8/h12-27H2,1-11H3/q+4 |
| InChIKey | SDZGIRUYOASWBI-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.85 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|