About sodium;tetraethylazanium;sulfate
sodium;tetraethylazanium;sulfate (PubChem CID 139985326) has the molecular formula C8H20NNaO4S
and a molecular weight of 249.31 g/mol. Its IUPAC name is sodium;tetraethylazanium;sulfate.
Molecular Properties
| Compound Name | sodium;tetraethylazanium;sulfate |
| PubChem CID | 139985326 |
| Molecular Formula | C8H20NNaO4S |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | sodium;tetraethylazanium;sulfate |
| SMILES | CC[N+](CC)(CC)CC.O=S(=O)([O-])[O-].[Na+] |
| InChI | InChI=1S/C8H20N.Na.H2O4S/c1-5-9(6-2,7-3)8-4;;1-5(2,3)4/h5-8H2,1-4H3;;(H2,1,2,3,4)/q2*+1;/p-2 |
| InChIKey | RAKWZYANAUAXTC-UHFFFAOYSA-L |
| XLogP | -2.45 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | -2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze sodium;tetraethylazanium;sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;tetraethylazanium;sulfate?
The IUPAC name of sodium;tetraethylazanium;sulfate (CID 139985326) is sodium;tetraethylazanium;sulfate.
What is the SMILES notation for sodium;tetraethylazanium;sulfate?
The canonical SMILES for sodium;tetraethylazanium;sulfate is CC[N+](CC)(CC)CC.O=S(=O)([O-])[O-].[Na+].
What is the InChIKey of sodium;tetraethylazanium;sulfate?
The InChIKey is RAKWZYANAUAXTC-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H20N.Na.H2O4S/c1-5-9(6-2,7-3)8-4;;1-5(2,3)4/h5-8H2,1-4H3;;(H2,1,2,3,4)/q2*+1;/p-2.
What are the key properties of sodium;tetraethylazanium;sulfate?
sodium;tetraethylazanium;sulfate has a molecular weight of 249.31 g/mol, XLogP of -2.45, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;tetraethylazanium;sulfate is sourced from PubChem (CID 139985326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).