C12H25F4NO3S — CID 145140201
tetraethylazanium;2,2,3,3-tetrafluorobutane-1-sulfonate (PubChem CID 145140201) has the molecular formula C12H25F4NO3S and a molecular weight of 339.40 g/mol. Its IUPAC name is tetraethylazanium;2,2,3,3-tetrafluorobutane-1-sulfonate.
| Compound Name | tetraethylazanium;2,2,3,3-tetrafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 145140201 |
| Molecular Formula | C12H25F4NO3S |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.15 |
| IUPAC Name | tetraethylazanium;2,2,3,3-tetrafluorobutane-1-sulfonate |
| SMILES | CC(F)(F)C(F)(F)CS(=O)(=O)[O-].CC[N+](CC)(CC)CC |
| InChI | InChI=1S/C8H20N.C4H6F4O3S/c1-5-9(6-2,7-3)8-4;1-3(5,6)4(7,8)2-12(9,10)11/h5-8H2,1-4H3;2H2,1H3,(H,9,10,11)/q+1;/p-1 |
| InChIKey | UBYNXOPIFWDXDH-UHFFFAOYSA-M |
| XLogP | 2.70 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|